| 
 | Compound Information | SONAR Target prediction |  | Name: | CLENBUTEROL HYDROCHLORIDE |  | Unique Identifier: | SPE01503917 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 294.499 g/mol |  | X log p: | 4.219  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 0 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 3 |  | Rotatable Bond Count: | 4 |  | Canonical Smiles: | Cl.CC(C)(C)NCC(O)c1cc(Cl)c(N)c(Cl)c1 |  | Source: | synthetic; NAB-365 |  | Therapeutics: | bronchodilator, beta2 adrenergic agonist | 
 
 
	
		| Species: | 4932 |  
		| Condition: | BRE1 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.5128±0.0123037 |  
		| Normalized OD Score: sc h | 0.9995±0.0156675 |  
		| Z-Score: | -0.0153±0.284071 |  
		| p-Value: | 0.84082 |  
		| Z-Factor: | -56.1875 |  
		| Fitness Defect: | 0.1734 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 17|F10 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 26.10 Celcius |  | Date: | 2006-03-16 YYYY-MM-DD |  | Plate CH Control (+): | 0.039099999999999996±0.00108 |  | Plate DMSO Control (-): | 0.514475±0.00870 |  | Plate Z-Factor: | 0.9355 | 
 |  png ps
 pdf
 | 
 
 
	
		| 2783 | 1-(4-amino-3,5-dichloro-phenyl)-2-(tert-butylamino)ethanol |  
		| 30849 | [2-(4-amino-3,5-dichloro-phenyl)-2-hydroxy-ethyl]-tert-butyl-azanium chloride |  
		| 217246 | 1-(4-amino-3,5-dichloro-phenyl)-2-(propan-2-ylamino)ethanol |  
		| 688427 | (1R)-1-(4-amino-3,5-dichloro-phenyl)-2-(tert-butylamino)ethanol |  
		| 688428 | (1S)-1-(4-amino-3,5-dichloro-phenyl)-2-(tert-butylamino)ethanol |  
		| 5231296 | [2-(4-amino-3,5-dichloro-phenyl)-2-hydroxy-ethyl]-tert-butyl-azanium |  
 | internal high similarity DBLink  | Rows returned: 0 |  | 
 
 
 |