| Compound Information | SONAR Target prediction | | Name: | CLENBUTEROL HYDROCHLORIDE | | Unique Identifier: | SPE01503917 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 294.499 g/mol | | X log p: | 4.219 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | Cl.CC(C)(C)NCC(O)c1cc(Cl)c(N)c(Cl)c1 | | Source: | synthetic; NAB-365 | | Therapeutics: | bronchodilator, beta2 adrenergic agonist |
| Species: |
4932 |
| Condition: |
ROM2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6738±0.00806102 |
| Normalized OD Score: sc h |
0.9906±0.00608701 |
| Z-Score: |
-0.4181±0.282505 |
| p-Value: |
0.681946 |
| Z-Factor: |
-161.397 |
| Fitness Defect: |
0.3828 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 17|F10 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.70 Celcius | | Date: | 2007-11-21 YYYY-MM-DD | | Plate CH Control (+): | 0.0422±0.00169 | | Plate DMSO Control (-): | 0.660925±0.02801 | | Plate Z-Factor: | 0.8698 |
| png ps pdf |
| 5702273 |
1-(4-amino-3,5-dichloro-phenyl)-2-(tert-butylamino)ethanol hydrochloride |
| 6921737 |
[(2R)-2-(4-amino-3,5-dichloro-phenyl)-2-hydroxy-ethyl]-tert-butyl-azanium |
| 6921738 |
[(2S)-2-(4-amino-3,5-dichloro-phenyl)-2-hydroxy-ethyl]-tert-butyl-azanium |
| 16048573 |
(1S)-1-(4-amino-3,5-dichloro-phenyl)-2-(tert-butylamino)ethanol hydrochloride |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 17428 | Additional Members: 9 | Rows returned: 0 | |
|