| Compound Information | SONAR Target prediction |  | Name: | CLENBUTEROL HYDROCHLORIDE |  | Unique Identifier: | SPE01503917  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 294.499 g/mol |  | X log p: | 4.219  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 0 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 3 |  | Rotatable Bond Count: | 4 |  | Canonical Smiles: | Cl.CC(C)(C)NCC(O)c1cc(Cl)c(N)c(Cl)c1 |  | Source: | synthetic; NAB-365 |  | Therapeutics: | bronchodilator, beta2 adrenergic agonist |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		RAD50 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.6548±0.000494975 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9895±0.00172273 | 
	 
	
		| Z-Score: | 
		-0.4184±0.0758266 | 
	 
	
		| p-Value: | 
		0.67607 | 
	 
	
		| Z-Factor: | 
		-12.335 | 
	 
	
		| Fitness Defect: | 
		0.3915 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 17|F10 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 26.40 Celcius |  | Date: | 2007-09-07 YYYY-MM-DD |  | Plate CH Control (+): | 0.041975±0.00094 |  | Plate DMSO Control (-): | 0.6365±0.02275 |  | Plate Z-Factor: | 0.8942 |  
  |  png ps pdf |  
 
 
	
		| 5702273 | 
		1-(4-amino-3,5-dichloro-phenyl)-2-(tert-butylamino)ethanol hydrochloride | 
	 
	
		| 6921737 | 
		[(2R)-2-(4-amino-3,5-dichloro-phenyl)-2-hydroxy-ethyl]-tert-butyl-azanium | 
	 
	
		| 6921738 | 
		[(2S)-2-(4-amino-3,5-dichloro-phenyl)-2-hydroxy-ethyl]-tert-butyl-azanium | 
	 
	
		| 16048573 | 
		(1S)-1-(4-amino-3,5-dichloro-phenyl)-2-(tert-butylamino)ethanol hydrochloride | 
	 
 
 | internal high similarity DBLink  | Rows returned: 0 |  |  
 
 |  active | Cluster 17428 | Additional Members: 9 | Rows returned: 0 |  |  
  
 |