Compound Information | SONAR Target prediction | Name: | CLENBUTEROL HYDROCHLORIDE | Unique Identifier: | SPE01503917 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 294.499 g/mol | X log p: | 4.219 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 4 | Canonical Smiles: | Cl.CC(C)(C)NCC(O)c1cc(Cl)c(N)c(Cl)c1 | Source: | synthetic; NAB-365 | Therapeutics: | bronchodilator, beta2 adrenergic agonist |
Species: |
4932 |
Condition: |
SNF2 |
Replicates: |
2 |
Raw OD Value: r im |
0.5453±0.00424264 |
Normalized OD Score: sc h |
0.9712±0.0382392 |
Z-Score: |
-0.7327±1.1898 |
p-Value: |
0.514502 |
Z-Factor: |
-13.4488 |
Fitness Defect: |
0.6646 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 22|E11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.00 Celcius | Date: | 2008-02-01 YYYY-MM-DD | Plate CH Control (+): | 0.04005±0.00024 | Plate DMSO Control (-): | 0.52415±0.03218 | Plate Z-Factor: | 0.8104 |
| png ps pdf |
5702273 |
1-(4-amino-3,5-dichloro-phenyl)-2-(tert-butylamino)ethanol hydrochloride |
6921737 |
[(2R)-2-(4-amino-3,5-dichloro-phenyl)-2-hydroxy-ethyl]-tert-butyl-azanium |
6921738 |
[(2S)-2-(4-amino-3,5-dichloro-phenyl)-2-hydroxy-ethyl]-tert-butyl-azanium |
16048573 |
(1S)-1-(4-amino-3,5-dichloro-phenyl)-2-(tert-butylamino)ethanol hydrochloride |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 17428 | Additional Members: 9 | Rows returned: 0 | |
|