| Compound Information | SONAR Target prediction |  | Name: | CLENBUTEROL HYDROCHLORIDE |  | Unique Identifier: | SPE01503917  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 294.499 g/mol |  | X log p: | 4.219  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 0 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 3 |  | Rotatable Bond Count: | 4 |  | Canonical Smiles: | Cl.CC(C)(C)NCC(O)c1cc(Cl)c(N)c(Cl)c1 |  | Source: | synthetic; NAB-365 |  | Therapeutics: | bronchodilator, beta2 adrenergic agonist |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		NDI1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.7031±0.000141421 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0144±0.00372748 | 
	 
	
		| Z-Score: | 
		0.6632±0.173428 | 
	 
	
		| p-Value: | 
		0.510386 | 
	 
	
		| Z-Factor: | 
		-4.8388 | 
	 
	
		| Fitness Defect: | 
		0.6726 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 22|E11 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 21.60 Celcius |  | Date: | 2008-03-13 YYYY-MM-DD |  | Plate CH Control (+): | 0.0395±0.00049 |  | Plate DMSO Control (-): | 0.6676±0.02295 |  | Plate Z-Factor: | 0.8650 |  
  |  png ps pdf |  
 
 
	
		| 2783 | 
		1-(4-amino-3,5-dichloro-phenyl)-2-(tert-butylamino)ethanol | 
	 
	
		| 30849 | 
		[2-(4-amino-3,5-dichloro-phenyl)-2-hydroxy-ethyl]-tert-butyl-azanium chloride | 
	 
	
		| 217246 | 
		1-(4-amino-3,5-dichloro-phenyl)-2-(propan-2-ylamino)ethanol | 
	 
	
		| 688427 | 
		(1R)-1-(4-amino-3,5-dichloro-phenyl)-2-(tert-butylamino)ethanol | 
	 
	
		| 688428 | 
		(1S)-1-(4-amino-3,5-dichloro-phenyl)-2-(tert-butylamino)ethanol | 
	 
	
		| 5231296 | 
		[2-(4-amino-3,5-dichloro-phenyl)-2-hydroxy-ethyl]-tert-butyl-azanium | 
	 
 
 | internal high similarity DBLink  | Rows returned: 0 |  |  
 
 |  active | Cluster 17428 | Additional Members: 9 | Rows returned: 0 |  |  
  
 |