| Compound Information | SONAR Target prediction |
| Name: | CYCLOPIAZONIC ACID |
| Unique Identifier: | SPE01503912 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C20H20N2O3 |
| Molecular Weight: | 316.226 g/mol |
| X log p: | 7.932 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 37.38 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 5 |
| Rotatable Bond Count: | 1 |
| Canonical Smiles: | CC(=O)C1=C(O)C2C3C(Cc4cccc5ncc3c45)C(C)(C)N2C1=O |
| Therapeutics: | inhibits endoplamic reticulum Ca ATPase |
| Found: 101 nonactive as graph: single | with analogs | [1] << Back 31 32 33 34 35 36 37 38 39 40 Next >> [101] |
| Species: | 4932 |
| Condition: | GAS1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.4014±0.0484368 |
| Normalized OD Score: sc h | 1.0757±0.0753848 |
| Z-Score: | 0.7161±0.673251 |
| p-Value: | 0.521724 |
| Z-Factor: | -7.15407 |
| Fitness Defect: | 0.6506 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 4333 | Additional Members: 2 | Rows returned: 0 |
Service provided by the
Mike Tyers Laboratory