| Compound Information | SONAR Target prediction |  | Name: | ANISOMYCIN |  | Unique Identifier: | SPE01503906  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 246.154 g/mol |  | X log p: | 8.199  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 35.53 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 5 |  | Rotatable Bond Count: | 5 |  | Canonical Smiles: | COc1ccc(CC2NCC(O)C2OC(C)=O)cc1 |  | Class: | alkaloid |  | Source: | Streptomyces griseolus |  | Reference: | JACS 76:4053 (1954); Chem Pharm Bull 17:1405 (1969); Prog Neurobiology 16:155 (1981); Mol Cell Biochem 14:7352 (1994) |  | Therapeutics: | antiprotozoal, antifungal, protein synthesis inhibitor |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		GYP1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.5597±0.00615183 | 
	 
	
		| Normalized OD Score: sc h | 
		0.7752±0.0110101 | 
	 
	
		| Z-Score: | 
		-12.4038±0.644776 | 
	 
	
		| p-Value: | 
		3.32846e-33 | 
	 
	
		| Z-Factor: | 
		0.529 | 
	 
	
		| Fitness Defect: | 
		74.7828 | 
	 
	
		| Bioactivity Statement: | 
		Active | 
	 
 
| Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 7|F6 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 24.80 Celcius |  | Date: | 2008-06-10 YYYY-MM-DD |  | Plate CH Control (+): | 0.041075±0.00055 |  | Plate DMSO Control (-): | 0.7056±0.01713 |  | Plate Z-Factor: | 0.9193 |  
  |  png ps pdf |  
 
 
	
		| 2199 | 
		[4-hydroxy-2-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl] acetate | 
	 
	
		| 31549 | 
		[(2S,3R,4R)-4-hydroxy-2-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl] acetate | 
	 
	
		| 253602 | 
		[(2R,3S,4S)-4-hydroxy-2-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl] acetate | 
	 
	
		| 462385 | 
		[(2S,3R,4R)-4-hydroxy-2-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl] acetate hydrochloride | 
	 
	
		| 1268331 | 
		[(2R,3R,4R)-4-hydroxy-2-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl] acetate | 
	 
	
		| 5458313 | 
		[(2S,3R,4R)-4-hydroxy-2-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl] acetate chloride | 
	 
 
 | internal high similarity DBLink  | Rows returned: 0 |  |  
 
 |  nonactive | Cluster 6951 | Additional Members: 3 | Rows returned: 1 |  |   
 
 |