| Compound Information | SONAR Target prediction | | Name: | ANISOMYCIN | | Unique Identifier: | SPE01503906 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 246.154 g/mol | | X log p: | 8.199 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 35.53 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | COc1ccc(CC2NCC(O)C2OC(C)=O)cc1 | | Class: | alkaloid | | Source: | Streptomyces griseolus | | Reference: | JACS 76:4053 (1954); Chem Pharm Bull 17:1405 (1969); Prog Neurobiology 16:155
(1981); Mol Cell Biochem 14:7352 (1994) | | Therapeutics: | antiprotozoal, antifungal, protein synthesis inhibitor |
| Species: |
4932 |
| Condition: |
ABP1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5774±0.00311127 |
| Normalized OD Score: sc h |
0.8350±0.00531021 |
| Z-Score: |
-8.4453±0.652112 |
| p-Value: |
7.073e-16 |
| Z-Factor: |
0.493341 |
| Fitness Defect: |
34.8851 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 7|F6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 22.30 Celcius | | Date: | 2007-12-20 YYYY-MM-DD | | Plate CH Control (+): | 0.041825±0.00066 | | Plate DMSO Control (-): | 0.670175±0.01475 | | Plate Z-Factor: | 0.9306 |
|  png
ps
pdf |
| 2199 |
[4-hydroxy-2-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl] acetate |
| 31549 |
[(2S,3R,4R)-4-hydroxy-2-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl] acetate |
| 253602 |
[(2R,3S,4S)-4-hydroxy-2-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl] acetate |
| 462385 |
[(2S,3R,4R)-4-hydroxy-2-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl] acetate hydrochloride |
| 1268331 |
[(2R,3R,4R)-4-hydroxy-2-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl] acetate |
| 5458313 |
[(2S,3R,4R)-4-hydroxy-2-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl] acetate chloride |
| internal high similarity DBLink | Rows returned: 0 | |
| nonactive | Cluster 6951 | Additional Members: 3 | Rows returned: 1 | |
|
