| Compound Information | SONAR Target prediction | | Name: | ANISOMYCIN | | Unique Identifier: | SPE01503906 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 246.154 g/mol | | X log p: | 8.199 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 35.53 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | COc1ccc(CC2NCC(O)C2OC(C)=O)cc1 | | Class: | alkaloid | | Source: | Streptomyces griseolus | | Reference: | JACS 76:4053 (1954); Chem Pharm Bull 17:1405 (1969); Prog Neurobiology 16:155
(1981); Mol Cell Biochem 14:7352 (1994) | | Therapeutics: | antiprotozoal, antifungal, protein synthesis inhibitor |
| Species: |
4932 |
| Condition: |
HOG1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.4935±0.0346482 |
| Normalized OD Score: sc h |
0.9775±0.00354617 |
| Z-Score: |
-0.6125±0.0055576 |
| p-Value: |
0.540228 |
| Z-Factor: |
-10.0555 |
| Fitness Defect: |
0.6158 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum_ED | | Plate Number and Position: | 19|D7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 595 nm | | Robot Temperature: | 30.00 Celcius | | Date: | 2010-08-10 YYYY-MM-DD | | Plate CH Control (+): | 0.08549999999999999±0.00250 | | Plate DMSO Control (-): | 0.6507499999999999±0.02815 | | Plate Z-Factor: | 0.7899 |
|  png
ps
pdf |
| 2199 |
[4-hydroxy-2-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl] acetate |
| 31549 |
[(2S,3R,4R)-4-hydroxy-2-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl] acetate |
| 253602 |
[(2R,3S,4S)-4-hydroxy-2-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl] acetate |
| 462385 |
[(2S,3R,4R)-4-hydroxy-2-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl] acetate hydrochloride |
| 1268331 |
[(2R,3R,4R)-4-hydroxy-2-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl] acetate |
| 5458313 |
[(2S,3R,4R)-4-hydroxy-2-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl] acetate chloride |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 6951 | Additional Members: 3 | Rows returned: 0 | |
|
