Compound Information | SONAR Target prediction | Name: | ANISOMYCIN | Unique Identifier: | SPE01503906 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 246.154 g/mol | X log p: | 8.199 (online calculus) | Lipinksi Failures | 1 | TPSA | 35.53 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 5 | Canonical Smiles: | COc1ccc(CC2NCC(O)C2OC(C)=O)cc1 | Class: | alkaloid | Source: | Streptomyces griseolus | Reference: | JACS 76:4053 (1954); Chem Pharm Bull 17:1405 (1969); Prog Neurobiology 16:155 (1981); Mol Cell Biochem 14:7352 (1994) | Therapeutics: | antiprotozoal, antifungal, protein synthesis inhibitor |
Species: |
4932 |
Condition: |
CLB2 |
Replicates: |
2 |
Raw OD Value: r im |
0.7267±0.0573464 |
Normalized OD Score: sc h |
1.0670±0.0892713 |
Z-Score: |
3.8063±5.05994 |
p-Value: |
0.409658 |
Z-Factor: |
-4.30739 |
Fitness Defect: |
0.8924 |
Bioactivity Statement: |
Outlier |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 17|F9 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.70 Celcius | Date: | 2007-11-02 YYYY-MM-DD | Plate CH Control (+): | 0.042375±0.00147 | Plate DMSO Control (-): | 0.666425±0.01730 | Plate Z-Factor: | 0.9016 |
| png ps pdf |
2199 |
[4-hydroxy-2-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl] acetate |
31549 |
[(2S,3R,4R)-4-hydroxy-2-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl] acetate |
253602 |
[(2R,3S,4S)-4-hydroxy-2-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl] acetate |
462385 |
[(2S,3R,4R)-4-hydroxy-2-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl] acetate hydrochloride |
1268331 |
[(2R,3R,4R)-4-hydroxy-2-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl] acetate |
5458313 |
[(2S,3R,4R)-4-hydroxy-2-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl] acetate chloride |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 6951 | Additional Members: 3 | Rows returned: 0 | |
|