| Compound Information | SONAR Target prediction |
| Name: | AMCINONIDE |
| Unique Identifier: | SPE01503816 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 467.294 g/mol |
| X log p: | 4.288 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 78.9 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 7 |
| Rotatable Bond Count: | 4 |
| Canonical Smiles: | CC(=O)OCC(=O)C12OC3(CCCC3)OC1CC1C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC12C |
| Source: | synthetic |
| Therapeutics: | glucocorticoid, antiinflammatory |
| Generic_name: | Amcinonide |
| Drug_type: | Approved Drug |
| Pharmgkb_id: | PA448364 |
| Kegg_compound_id: | D01387 |
| Drugbank_id: | APRD00788 |
| Logp: | 3.269 |
| Cas_registry_number: | 51022-69-6 |
| Drug_category: | Corticosteroids, topical; ATC:D07AC11 |
| Indication: | For the relief of the inflammatory and pruritic manifestations of corticosteroid-responsive dermatoses. |
| Pharmacology: | Amcinonide is a topical corticosteroid. The topical corticosteroids constitute a class of primarily synthetic steroids used as anti-inflammatory and antipruritic agents. Amcinonide reduces or inhibits the actions of chemicals in the body that cause inflammation, redness, and swelling. The mechanism of anti-inflammatory activity of the topical corticosteroids is unclear. Various laboratory methods, including vasoconstrictor assays, are used to compare and predict potencies and/or clinical efficacies of the topical corticosteroids. There is some evidence to suggest that a recognizable correlation exists between vasoconstrictor potency and therapeutic efficacy in man. When in an ointment form, amcinonide also helps the skin maintain moisture. |
| Mechanism_of_action: | The mechanism of the anti-inflammatory activity of the topical steroids, in general, is unclear. However, corticosteroids are thought to act by the induction of phospholipase A2 inhibitory proteins, collectively called lipocortins. It is postulated that these proteins control the biosynthesis of potent mediators of inflammation such as prostaglandins and leukotrienes by inhibiting the release of their common precursor, arachidonic acid. Arachidonic acid is released from membrane phospholipids by phospholipase A2. Amcinonide has affinity for the glucocorticoid receptor. It has weak affinity for the progesterone receptor, and virtually no affinity for the mineralocorticoid, estrogen, or androgen receptors. |
| Organisms_affected: | Humans and other mammals |
| Found: 205 nonactive as graph: single | with analogs | [1] << Back 101 102 103 104 105 106 107 108 109 110 Next >> [205] |
| Species: | 4932 |
| Condition: | BCK2 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.7744±0.0059397 |
| Normalized OD Score: sc h | 1.0182±0.00731004 |
| Z-Score: | 0.7529±0.213883 |
| p-Value: | 0.456632 |
| Z-Factor: | -4.80489 |
| Fitness Defect: | 0.7839 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 4 |
| 2133 |
| 39858 |
| 443958 |
| 5702266 |
| internal high similarity DBLink | Rows returned: 2 |
| SPE01500587 | 0.9194 |
| SPE01500303 | 0.9385 |
| active | Cluster 1865 | Additional Members: 13 | Rows returned: 3 |
| Prest990 | 0.494845360824742 |
| SPE01500136 | 0.494845360824742 |
| SPE01503210 | 0.355555555555556 |
Service provided by the
Mike Tyers Laboratory