| 
 | Compound Information | SONAR Target prediction |  | Name: | METHYLPREDNISOLONE SODIUM SUCCINATE |  | Unique Identifier: | SPE01503723 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C26H33NaO8 |  | Molecular Weight: | 463.263 g/mol |  | X log p: | 3.113  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 100.57 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 8 |  | Rotatable Bond Count: | 7 |  | Canonical Smiles: | [Na+].[O-]C(=O)CCC(=O)OCC(=O)C1(O)CCC2C3CC(C)C4=CC(=O)C=CC4(C)C3C(O)CC 21C
 |  | Therapeutics: | antiinflammatory, glucocorticoid | 
 
 
	
		| Species: | 4932 |  
		| Condition: | BRE1 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.7204±0.010253 |  
		| Normalized OD Score: sc h | 0.9941±0.00161559 |  
		| Z-Score: | -0.2401±0.0673713 |  
		| p-Value: | 0.810436 |  
		| Z-Factor: | -4.59247 |  
		| Fitness Defect: | 0.2102 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 5|H5 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 26.70 Celcius |  | Date: | 2006-03-16 YYYY-MM-DD |  | Plate CH Control (+): | 0.039675±0.00100 |  | Plate DMSO Control (-): | 0.7018±0.01483 |  | Plate Z-Factor: | 0.9196 | 
 |  png ps
 pdf
 | 
 
 
	
		| 1875 | 4-[2-(11,17-dihydroxy-6,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren -17-yl)-2-oxo-ethoxy]-4-oxo-butanoic acid
 |  
		| 4897 | 4-[2-(11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17 -yl)-2-oxo-ethoxy]-4-oxo-butanoic acid
 |  
		| 15582 | sodium 4-[2-(11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17
 -yl)-2-oxo-ethoxy]-4-oxo-butanoate
 |  
		| 16922 | sodium 4-[2-[(6S,8S,9S,10S,11S,13S,14S,17R)-11,17-dihydroxy-6,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahy
 dro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethoxy]-4-oxo-butanoate
 |  
		| 16923 | 4-[2-[(6S,8S,9S,10S,11S,13S,14S,17R)-11,17-dihydroxy-6,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahy dro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethoxy]-4-oxo-butanoic acid
 |  
		| 63017 | 4-[[(6S,8S,9S,10S,11S,13S,14S,17R)-11-hydroxy-17-(2-hydroxyacetyl)-6,10,13-trimethyl-3-oxo-7,8,9,11,12,1 4,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]oxy]-4-oxo-butanoic acid
 |  
 | internal high similarity DBLink  | Rows returned: 5 |  | 
 
 | active | Cluster 8234 | Additional Members: 4 | Rows returned: 0 |  | 
 
 |