| Compound Information | SONAR Target prediction | | Name: | METHYLPREDNISOLONE SODIUM SUCCINATE | | Unique Identifier: | SPE01503723 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C26H33NaO8 | | Molecular Weight: | 463.263 g/mol | | X log p: | 3.113 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 100.57 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 8 | | Rotatable Bond Count: | 7 | | Canonical Smiles: | [Na+].[O-]C(=O)CCC(=O)OCC(=O)C1(O)CCC2C3CC(C)C4=CC(=O)C=CC4(C)C3C(O)CC
21C | | Therapeutics: | antiinflammatory, glucocorticoid |
| Species: |
4932 |
| Condition: |
SAP30 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7308±0.00360624 |
| Normalized OD Score: sc h |
1.0151±0.00936852 |
| Z-Score: |
0.5481±0.373048 |
| p-Value: |
0.596536 |
| Z-Factor: |
-3.21354 |
| Fitness Defect: |
0.5166 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 5|H5 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 21.70 Celcius | | Date: | 2006-03-08 YYYY-MM-DD | | Plate CH Control (+): | 0.039275000000000004±0.00123 | | Plate DMSO Control (-): | 0.70505±0.01224 | | Plate Z-Factor: | 0.9350 |
|  png
ps
pdf |
| 6560320 |
4-[2-[(8R,9S,10R,11S,13R,14S,17S)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H
-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethoxy]-4-oxo-butanoic acid |
| 6708814 |
4-[2-[(6S,11S,17R)-11,17-dihydroxy-6,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[
a]phenanthren-17-yl]-2-oxo-ethoxy]-4-oxo-butanoic acid |
| 7060965 |
4-[2-[(8S,9R,10S,11S,13S,14R,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H
-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethoxy]-4-oxo-butanoate |
| 7060966 |
4-[2-[(8S,9R,10S,11S,13S,14R,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H
-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethoxy]-4-oxo-butanoic acid |
| 7060967 |
4-[2-[(8S,9S,10S,11S,13S,14R,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H
-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethoxy]-4-oxo-butanoate |
| 7060968 |
4-[2-[(8S,9S,10S,11S,13S,14R,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H
-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethoxy]-4-oxo-butanoic acid |
| internal high similarity DBLink | Rows returned: 5 | |
| active | Cluster 8234 | Additional Members: 4 | Rows returned: 0 | |
|
