Compound Information | SONAR Target prediction | Name: | METHYLPREDNISOLONE SODIUM SUCCINATE | Unique Identifier: | SPE01503723 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C26H33NaO8 | Molecular Weight: | 463.263 g/mol | X log p: | 3.113 (online calculus) | Lipinksi Failures | 0 | TPSA | 100.57 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 8 | Rotatable Bond Count: | 7 | Canonical Smiles: | [Na+].[O-]C(=O)CCC(=O)OCC(=O)C1(O)CCC2C3CC(C)C4=CC(=O)C=CC4(C)C3C(O)CC 21C | Therapeutics: | antiinflammatory, glucocorticoid |
Species: |
4932 |
Condition: |
CIN8 |
Replicates: |
2 |
Raw OD Value: r im |
0.8137±0.00537401 |
Normalized OD Score: sc h |
1.0052±0.00646434 |
Z-Score: |
0.2836±0.348426 |
p-Value: |
0.783234 |
Z-Factor: |
-28.7242 |
Fitness Defect: |
0.2443 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 5|H5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.60 Celcius | Date: | 2006-02-24 YYYY-MM-DD | Plate CH Control (+): | 0.039175±0.00113 | Plate DMSO Control (-): | 0.777625±0.01833 | Plate Z-Factor: | 0.9211 |
| png ps pdf |
257628 |
3-[2-[(6S,8S,9S,10S,11S,13S,14S,17R)-11,17-dihydroxy-6,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahy dro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethoxy]carbonyl-2-ethyl-pentanoic acid |
443929 |
sodium 4-[2-[(8S,9S,10S,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H -cyclopenta[a]phenanthren-17-yl]-2-oxo-ethoxy]-4-oxo-butanoate |
656804 |
4-[2-[(8S,9S,10S,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H -cyclopenta[a]phenanthren-17-yl]-2-oxo-ethoxy]-4-oxo-butanoic acid |
4392599 |
3-[2-(11,17-dihydroxy-6,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren -17-yl)-2-oxo-ethoxy]carbonyl-2-ethyl-pentanoic acid |
5108833 |
4-[2-(11,17-dihydroxy-6,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren -17-yl)-2-oxo-ethoxy]-4-oxo-butanoate |
6560319 |
4-[2-[(8R,9S,10R,11S,13R,14S,17S)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H -cyclopenta[a]phenanthren-17-yl]-2-oxo-ethoxy]-4-oxo-butanoate |
internal high similarity DBLink | Rows returned: 5 | |
active | Cluster 8234 | Additional Members: 4 | Rows returned: 0 | |
|