| Compound Information | SONAR Target prediction |
| Name: | METHIOTHEPIN MALEATE |
| Unique Identifier: | SPE01503637 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C24H28N2O4S2 |
| Molecular Weight: | 444.4 g/mol |
| X log p: | 15.562 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 57.08 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 2 |
| Rotatable Bond Count: | 2 |
| Canonical Smiles: | CSc1ccc2Sc3ccccc3CC(N3CCN(C)CC3)c2c1.OC(=O)C=CC(O)=O |
| Therapeutics: | 5HT1&2 receptor antagonist |