| Compound Information | SONAR Target prediction | | Name: | THALIDOMIDE | | Unique Identifier: | SPE01503607 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 248.15 g/mol | | X log p: | 6.737 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 71.52 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 6 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | O=C1CCC(n2c(=O)c3ccccc3c2=O)C(=O)N1 | | Source: | synthetic | | Therapeutics: | hypnotic |
| Species: |
4932 |
| Condition: |
RVS167 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7157±0.00523259 |
| Normalized OD Score: sc h |
0.9915±0.00530818 |
| Z-Score: |
-0.4690±0.278243 |
| p-Value: |
0.645508 |
| Z-Factor: |
-11.0049 |
| Fitness Defect: |
0.4377 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 23|E7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.00 Celcius | | Date: | 2007-11-14 YYYY-MM-DD | | Plate CH Control (+): | 0.040825±0.00127 | | Plate DMSO Control (-): | 0.7118249999999999±0.02066 | | Plate Z-Factor: | 0.8926 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 5426 |
2-(2,6-dioxo-3-piperidyl)isoindole-1,3-dione |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 7702 | Additional Members: 4 | Rows returned: 0 | |
|