| Compound Information | SONAR Target prediction | | Name: | THALIDOMIDE | | Unique Identifier: | SPE01503607 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 248.15 g/mol | | X log p: | 6.737 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 71.52 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 6 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | O=C1CCC(n2c(=O)c3ccccc3c2=O)C(=O)N1 | | Source: | synthetic | | Therapeutics: | hypnotic |
| Species: |
4932 |
| Condition: |
KAR3 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6346±0.0046669 |
| Normalized OD Score: sc h |
0.9879±0.0124819 |
| Z-Score: |
-0.5750±0.59861 |
| p-Value: |
0.59879 |
| Z-Factor: |
-13.8366 |
| Fitness Defect: |
0.5128 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 23|E7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.50 Celcius | | Date: | 2007-09-06 YYYY-MM-DD | | Plate CH Control (+): | 0.04205±0.00117 | | Plate DMSO Control (-): | 0.6291±0.01824 | | Plate Z-Factor: | 0.9008 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 5426 |
2-(2,6-dioxo-3-piperidyl)isoindole-1,3-dione |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 7702 | Additional Members: 4 | Rows returned: 0 | |
|
