Compound Information | SONAR Target prediction | Name: | SEMUSTINE | Unique Identifier: | SPE01503422 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 229.579 g/mol | X log p: | 0.337 (online calculus) | Lipinksi Failures | 0 | TPSA | 49.74 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 6 | Canonical Smiles: | CC1CCC(CC1)NC(=O)N(CCCl)N=O | Source: | synthetic | Therapeutics: | antineoplastic |
Species: |
4932 |
Condition: |
SPE01501139 |
Replicates: |
2 |
Raw OD Value: r im |
0.0551±0.00155563 |
Normalized OD Score: sc h |
0.0620±0.0000437242 |
Z-Score: |
-20.6454±0.211424 |
p-Value: |
0 |
Z-Factor: |
0.395476 |
Fitness Defect: |
INF |
Bioactivity Statement: |
Toxic |
Experimental Conditions | | Library: | SpectrumTMP | Plate Number and Position: | 2|F7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 22.10 Celcius | Date: | 2006-11-22 YYYY-MM-DD | Plate CH Control (+): | 0.04045±0.00345 | Plate DMSO Control (-): | 0.873±0.19356 | Plate Z-Factor: | 0.3690 |
| png ps pdf |
314600 |
1-(2-chloroethyl)-3-[(1R,3R)-3-methylcyclohexyl]-1-nitroso-urea |
451206 |
1-(2-chloroethyl)-3-(2-cyclohexylethyl)-1-nitroso-urea |
3058228 |
1-(2-chloroethyl)-1-nitroso-3-[(1R,3S)-3-tert-butylcyclohexyl]urea |
3515106 |
1-(2-chloroethyl)-3-[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradeca hydro-1H-cyclopenta[a]phenanthren-3-yl]-1-nitroso-urea |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 2382 | Additional Members: 3 | Rows returned: 1 | |
|