| Compound Information | SONAR Target prediction | | Name: | SEMUSTINE | | Unique Identifier: | SPE01503422 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 229.579 g/mol | | X log p: | 0.337 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 49.74 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 6 | | Canonical Smiles: | CC1CCC(CC1)NC(=O)N(CCCl)N=O | | Source: | synthetic | | Therapeutics: | antineoplastic |
| Species: |
4932 |
| Condition: |
SPE01800123 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.0717±0.0376888 |
| Normalized OD Score: sc h |
0.2159±0.0371241 |
| Z-Score: |
-5.7937±0.0160752 |
| p-Value: |
0.00000000689942 |
| Z-Factor: |
-4.43084 |
| Fitness Defect: |
18.7918 |
| Bioactivity Statement: |
Toxic |
| Experimental Conditions | | | Library: | SpectrumTMP | | Plate Number and Position: | 2|F7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 0.00 Celcius | | Date: | 2007-01-19 YYYY-MM-DD | | Plate CH Control (+): | 0.21375000000000002±0.00638 | | Plate DMSO Control (-): | 0.41507499999999997±1.77238 | | Plate Z-Factor: | -0.2964 |
| png ps pdf |
| 314600 |
1-(2-chloroethyl)-3-[(1R,3R)-3-methylcyclohexyl]-1-nitroso-urea |
| 451206 |
1-(2-chloroethyl)-3-(2-cyclohexylethyl)-1-nitroso-urea |
| 3058228 |
1-(2-chloroethyl)-1-nitroso-3-[(1R,3S)-3-tert-butylcyclohexyl]urea |
| 3515106 |
1-(2-chloroethyl)-3-[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradeca hydro-1H-cyclopenta[a]phenanthren-3-yl]-1-nitroso-urea |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 2382 | Additional Members: 3 | Rows returned: 1 | |
|