| 
 | Compound Information | SONAR Target prediction |  | Name: | SEMUSTINE |  | Unique Identifier: | SPE01503422 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 229.579 g/mol |  | X log p: | 0.337  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 49.74 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 3 |  | Rotatable Bond Count: | 6 |  | Canonical Smiles: | CC1CCC(CC1)NC(=O)N(CCCl)N=O |  | Source: | synthetic |  | Therapeutics: | antineoplastic | 
 
 
	
		| Species: | 4932 |  
		| Condition: | SPE01504185 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.0609±0.00360624 |  
		| Normalized OD Score: sc h | 0.1648±0.039749 |  
		| Z-Score: | -7.5235±2.1641 |  
		| p-Value: | 0.00000000102838 |  
		| Z-Factor: | -4.71665 |  
		| Fitness Defect: | 20.6953 |  
		| Bioactivity Statement: | Toxic |  | | Experimental Conditions |  |  | Library: | SpectrumTMP |  | Plate Number and Position: | 2|F7 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 0.00 Celcius |  | Date: | 2007-01-19 YYYY-MM-DD |  | Plate CH Control (+): | 0.234625±0.00629 |  | Plate DMSO Control (-): | 0.4022±1.72858 |  | Plate Z-Factor: | 0.6657 | 
 |  png ps
 pdf
 | 
 
 
	
		| 314600 | 1-(2-chloroethyl)-3-[(1R,3R)-3-methylcyclohexyl]-1-nitroso-urea |  
		| 451206 | 1-(2-chloroethyl)-3-(2-cyclohexylethyl)-1-nitroso-urea |  
		| 3058228 | 1-(2-chloroethyl)-1-nitroso-3-[(1R,3S)-3-tert-butylcyclohexyl]urea |  
		| 3515106 | 1-(2-chloroethyl)-3-[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradeca hydro-1H-cyclopenta[a]phenanthren-3-yl]-1-nitroso-urea
 |  
 | internal high similarity DBLink  | Rows returned: 0 |  | 
 
 | active | Cluster 2382 | Additional Members: 3 | Rows returned: 1 |  | 
 
 |