| Compound Information | SONAR Target prediction |  | Name: | SEMUSTINE |  | Unique Identifier: | SPE01503422  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 229.579 g/mol |  | X log p: | 0.337  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 49.74 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 3 |  | Rotatable Bond Count: | 6 |  | Canonical Smiles: | CC1CCC(CC1)NC(=O)N(CCCl)N=O |  | Source: | synthetic |  | Therapeutics: | antineoplastic |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		BBR_HAL_tri_24h | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.0484±0.000494975 | 
	 
	
		| Normalized OD Score: sc h | 
		0.1040±0.00414865 | 
	 
	
		| Z-Score: | 
		-6.7850±0.353792 | 
	 
	
		| p-Value: | 
		0.0000000000328422 | 
	 
	
		| Z-Factor: | 
		0.175992 | 
	 
	
		| Fitness Defect: | 
		24.1393 | 
	 
	
		| Bioactivity Statement: | 
		Toxic | 
	 
 
| Experimental Conditions |  |  | Library: | SpectrumTMP |  | Plate Number and Position: | 2|F7 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 21.90 Celcius |  | Date: | 2007-04-11 YYYY-MM-DD |  | Plate CH Control (+): | 0.04095±0.00182 |  | Plate DMSO Control (-): | 0.520975±0.15499 |  | Plate Z-Factor: | 0.1239 |  
  |  png ps pdf |  
 
 
	
		| 208788 | 
		1-(2-chloroethyl)-3-(4-ethylcyclohexyl)-1-nitroso-urea | 
	 
	
		| 261233 | 
		1-(2-chloroethyl)-1-nitroso-3-(1,7,7-trimethylnorbornan-2-yl)urea | 
	 
	
		| 262108 | 
		1-(2-chloroethyl)-3-[(3R,5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5, 6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]-1-nitroso-urea | 
	 
	
		| 262479 | 
		1-(2-chloroethyl)-3-(1-methylcyclohexyl)-1-nitroso-urea | 
	 
	
		| 285728 | 
		1-(2-chloroethyl)-3-[4-[[4-[(2-chloroethyl-nitroso-carbamoyl)amino]cyclohexyl]methyl]cyclohexyl]-1-nitro so-urea | 
	 
	
		| 311786 | 
		1-(2-chloroethyl)-3-heptan-2-yl-1-nitroso-urea | 
	 
 
 | internal high similarity DBLink  | Rows returned: 0 |  |  
 
 |  active | Cluster 2382 | Additional Members: 3 | Rows returned: 1 |  |   
 
 |