| 
 | Compound Information | SONAR Target prediction |  | Name: | SEMUSTINE |  | Unique Identifier: | SPE01503422 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 229.579 g/mol |  | X log p: | 0.337  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 49.74 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 3 |  | Rotatable Bond Count: | 6 |  | Canonical Smiles: | CC1CCC(CC1)NC(=O)N(CCCl)N=O |  | Source: | synthetic |  | Therapeutics: | antineoplastic | 
 
 
	
		| Species: | 4932 |  
		| Condition: | SPE01503226 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.4921±0.0322441 |  
		| Normalized OD Score: sc h | 0.7568±0.0482804 |  
		| Z-Score: | -9.7647±1.65696 |  
		| p-Value: | 4.23478e-18 |  
		| Z-Factor: | -0.238635 |  
		| Fitness Defect: | 40.0032 |  
		| Bioactivity Statement: | Active |  | | Experimental Conditions |  |  | Library: | SpectrumTMP |  | Plate Number and Position: | 2|F7 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 595 nm |  | Robot Temperature: | 22.30 Celcius |  | Date: | 2006-12-12 YYYY-MM-DD |  | Plate CH Control (+): | 0.040075±0.00385 |  | Plate DMSO Control (-): | 0.639975±0.03042 |  | Plate Z-Factor: | 0.7612 | 
 |  png ps
 pdf
 | 
 
 
	
		| 208788 | 1-(2-chloroethyl)-3-(4-ethylcyclohexyl)-1-nitroso-urea |  
		| 261233 | 1-(2-chloroethyl)-1-nitroso-3-(1,7,7-trimethylnorbornan-2-yl)urea |  
		| 262108 | 1-(2-chloroethyl)-3-[(3R,5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5, 6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]-1-nitroso-urea
 |  
		| 262479 | 1-(2-chloroethyl)-3-(1-methylcyclohexyl)-1-nitroso-urea |  
		| 285728 | 1-(2-chloroethyl)-3-[4-[[4-[(2-chloroethyl-nitroso-carbamoyl)amino]cyclohexyl]methyl]cyclohexyl]-1-nitro so-urea
 |  
		| 311786 | 1-(2-chloroethyl)-3-heptan-2-yl-1-nitroso-urea |  
 | internal high similarity DBLink  | Rows returned: 0 |  | 
 
 | active | Cluster 2382 | Additional Members: 3 | Rows returned: 1 |  | 
 
 |