Compound Information | SONAR Target prediction | Name: | MIZORIBINE | Unique Identifier: | SPE01503416 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C9H13N3O6 | Molecular Weight: | 246.113 g/mol | X log p: | 2.276 (online calculus) | Lipinksi Failures | 0 | TPSA | 41.9 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 9 | Rotatable Bond Count: | 3 | Canonical Smiles: | NC(=O)c1ncn(C2OC(CO)C(O)C2O)c1O | Therapeutics: | immunosuppressant |
Species: |
4932 |
Condition: |
KAR3 |
Replicates: |
2 |
Raw OD Value: r im |
0.6492±0.00388909 |
Normalized OD Score: sc h |
1.0108±0.000374342 |
Z-Score: |
0.5071±0.031477 |
p-Value: |
0.612148 |
Z-Factor: |
-5.03336 |
Fitness Defect: |
0.4908 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 23|B7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.50 Celcius | Date: | 2007-09-06 YYYY-MM-DD | Plate CH Control (+): | 0.04205±0.00117 | Plate DMSO Control (-): | 0.6291±0.01824 | Plate Z-Factor: | 0.9008 |
| png ps pdf |
DBLink | Rows returned: 3 | |
4213 |
1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-hydroxy-imidazole-4-carboxamide |
104762 |
1-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-hydroxy-imidazole-4-carboxamide |
6603923 |
1-[(2R,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-hydroxy-imidazole-4-carboxamide |
internal high similarity DBLink | Rows returned: 1 | |
active | Cluster 9750 | Additional Members: 25 | Rows returned: 4 | |
|