Compound Information | SONAR Target prediction | Name: | MIZORIBINE | Unique Identifier: | SPE01503416 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C9H13N3O6 | Molecular Weight: | 246.113 g/mol | X log p: | 2.276 (online calculus) | Lipinksi Failures | 0 | TPSA | 41.9 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 9 | Rotatable Bond Count: | 3 | Canonical Smiles: | NC(=O)c1ncn(C2OC(CO)C(O)C2O)c1O | Therapeutics: | immunosuppressant |
Species: |
4932 |
Condition: |
IDH2 |
Replicates: |
2 |
Raw OD Value: r im |
0.5884±0.000777817 |
Normalized OD Score: sc h |
1.0163±0.00161839 |
Z-Score: |
0.8152±0.0611331 |
p-Value: |
0.415412 |
Z-Factor: |
-3.95799 |
Fitness Defect: |
0.8785 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 23|B7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.20 Celcius | Date: | 2007-10-19 YYYY-MM-DD | Plate CH Control (+): | 0.040925±0.00060 | Plate DMSO Control (-): | 0.56915±0.01239 | Plate Z-Factor: | 0.9294 |
| png ps pdf |
DBLink | Rows returned: 3 | |
4213 |
1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-hydroxy-imidazole-4-carboxamide |
104762 |
1-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-hydroxy-imidazole-4-carboxamide |
6603923 |
1-[(2R,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-hydroxy-imidazole-4-carboxamide |
internal high similarity DBLink | Rows returned: 1 | |
|