| Compound Information | SONAR Target prediction | | Name: | MIZORIBINE | | Unique Identifier: | SPE01503416 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C9H13N3O6 | | Molecular Weight: | 246.113 g/mol | | X log p: | 2.276 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 41.9 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 9 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | NC(=O)c1ncn(C2OC(CO)C(O)C2O)c1O | | Therapeutics: | immunosuppressant |
| Species: |
4932 |
| Condition: |
HTZ1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.1749±0.0762261 |
| Normalized OD Score: sc h |
0.8525±0.105715 |
| Z-Score: |
-0.8801±0.965254 |
| p-Value: |
0.480754 |
| Z-Factor: |
-5.51497 |
| Fitness Defect: |
0.7324 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 23|B7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.60 Celcius | | Date: | 2007-09-26 YYYY-MM-DD | | Plate CH Control (+): | 0.040325±0.00040 | | Plate DMSO Control (-): | 0.17195±0.07712 | | Plate Z-Factor: | -1.6407 |
| png ps pdf |
| DBLink | Rows returned: 3 | |
| 4213 |
1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-hydroxy-imidazole-4-carboxamide |
| 104762 |
1-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-hydroxy-imidazole-4-carboxamide |
| 6603923 |
1-[(2R,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-hydroxy-imidazole-4-carboxamide |
| internal high similarity DBLink | Rows returned: 1 | |
| active | Cluster 9750 | Additional Members: 25 | Rows returned: 4 | |
|