| Compound Information | SONAR Target prediction |
| Name: | PASINIAZID |
| Unique Identifier: | SPE01503381 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C13H14N4O4 |
| Molecular Weight: | 276.164 g/mol |
| X log p: | 4.869 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 17.07 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 4 |
| Rotatable Bond Count: | 1 |
| Canonical Smiles: | NNC(=O)c1ccncc1.Nc1ccc(C(O)=O)c(O)c1 |
| Therapeutics: | antibacterial (tuberculostatic) |
| Found: 101 nonactive as graph: single | with analogs | [1] << Back 51 52 53 54 55 56 57 58 59 60 Next >> [101] |
| Species: | 4932 |
| Condition: | MT2481-pdr1pdr3 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.7150±0.00770746 |
| Normalized OD Score: sc h | 1.0010±0.0027703 |
| Z-Score: | 0.0296±0.0872554 |
| p-Value: | 0.950824 |
| Z-Factor: | -7.49866 |
| Fitness Defect: | 0.0504 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 1 |
| 16367 | 4-amino-2-hydroxy-benzoic acid; pyridine-4-carbohydrazide |
| internal high similarity DBLink | Rows returned: 0 |
| nonactive | Cluster 8873 | Additional Members: 5 | Rows returned: 3 |
| SPE00305025 | 0.511111111111111 |
| Prest1250 | 0.393939393939394 |
| SPE01500116 | 0 |
Service provided by the
Mike Tyers Laboratory