| Compound Information | SONAR Target prediction |  | Name: | DIFLUCORTOLONE PIVALATE |  | Unique Identifier: | SPE01503299  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C27F2H36O5 |  | Molecular Weight: | 442.283 g/mol |  | X log p: | 5.144  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 60.44 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 5 |  | Rotatable Bond Count: | 5 |  | Canonical Smiles: | CC1CC2C3CC(F)C4=CC(=O)C=CC4(C)C3(F)C(O)CC2(C)C1C(=O)COC(=O)C(C)(C)C |  | Therapeutics: | glucocorticoid, antiinflammatory |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		CNB1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.7774±0.0234759 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9367±0.0287488 | 
	 
	
		| Z-Score: | 
		-3.1213±1.37808 | 
	 
	
		| p-Value: | 
		0.0159228 | 
	 
	
		| Z-Factor: | 
		-1.03914 | 
	 
	
		| Fitness Defect: | 
		4.14 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 10|C4 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.60 Celcius |  | Date: | 2006-03-03 YYYY-MM-DD |  | Plate CH Control (+): | 0.0392±0.00148 |  | Plate DMSO Control (-): | 0.813375±0.01085 |  | Plate Z-Factor: | 0.9604 |  
  |  png ps pdf |  
 
 
	
		| 3057 | 
		[2-(6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phe nanthren-17-yl)-2-oxo-ethyl] 2,2-dimethylpropanoate | 
	 
	
		| 3058 | 
		[2-(6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phe nanthren-17-yl)-2-oxo-ethyl] pentanoate | 
	 
	
		| 66381 | 
		[2-[(6S,8S,9R,10S,11S,13S,14S,16R,17S)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15, 16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] 2,2-dimethylpropanoate | 
	 
	
		| 91670 | 
		[2-[(6S,8S,9R,10S,11S,13S,14S,16R,17S)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15, 16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] pentanoate | 
	 
	
		| 133141 | 
		[2-[(6S,8S,10S,11S,13S,14S,16R,17S)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15,16, 17-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] pentanoate | 
	 
	
		| 5702241 | 
		[2-[(6S,11S,16R)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyc lopenta[a]phenanthren-17-yl]-2-oxo-ethyl] 2,2-dimethylpropanoate | 
	 
 
 | internal high similarity DBLink  | Rows returned: 1 |  |   
 |  active | Cluster 15366 | Additional Members: 3 | Rows returned: 0 |  |  
  
 |