| Compound Information | SONAR Target prediction | | Name: | DIFLUCORTOLONE PIVALATE | | Unique Identifier: | SPE01503299 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C27F2H36O5 | | Molecular Weight: | 442.283 g/mol | | X log p: | 5.144 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 60.44 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | CC1CC2C3CC(F)C4=CC(=O)C=CC4(C)C3(F)C(O)CC2(C)C1C(=O)COC(=O)C(C)(C)C | | Therapeutics: | glucocorticoid, antiinflammatory |
| Species: |
4932 |
| Condition: |
APC9 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7193±0.00289914 |
| Normalized OD Score: sc h |
1.0315±0.00421221 |
| Z-Score: |
1.7110±0.254631 |
| p-Value: |
0.092193 |
| Z-Factor: |
-7.33285 |
| Fitness Defect: |
2.3839 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 10|C4 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 23.10 Celcius | | Date: | 2007-11-22 YYYY-MM-DD | | Plate CH Control (+): | 0.04245±0.00129 | | Plate DMSO Control (-): | 0.685975±0.12244 | | Plate Z-Factor: | 0.4058 |
|  png
ps
pdf |
| 6454234 |
[2-[(6S,8S,10S,11S,13S,14S,16R,17S)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15,16,
17-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] hexanoate |
| internal high similarity DBLink | Rows returned: 1 | |
| active | Cluster 15366 | Additional Members: 3 | Rows returned: 0 | |
|
