| 
 | Compound Information | SONAR Target prediction |  | Name: | ROXITHROMYCIN |  | Unique Identifier: | SPE01503276 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 760.443 g/mol |  | X log p: | -1.64  (online calculus) |  | Lipinksi Failures | 2 |  | TPSA | 115.74 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 15 |  | Rotatable Bond Count: | 13 |  | Canonical Smiles: | CCC1OC(=O)C(C)C(OC2CC(C)(OC)C(O)C(C)O2)C(C)C(OC2OC(C)CC(C2O)N(C)C)C(C) (O)CC(C)C(=NOCOCCOC)C(C)C(O)C1(C)O
 |  | Source: | semisynthetic; RU-28965, RU-965 |  | Therapeutics: | antibacterial | 
 
 
	
		| Species: | 4932 |  
		| Condition: | RVS167 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.7305±0.00176777 |  
		| Normalized OD Score: sc h | 0.9986±0.00302947 |  
		| Z-Score: | -0.0768±0.16569 |  
		| p-Value: | 0.907006 |  
		| Z-Factor: | -100.51 |  
		| Fitness Defect: | 0.0976 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 14|C10 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 24.20 Celcius |  | Date: | 2007-11-14 YYYY-MM-DD |  | Plate CH Control (+): | 0.040675±0.00040 |  | Plate DMSO Control (-): | 0.720675±0.01220 |  | Plate Z-Factor: | 0.9541 | 
 |  png ps
 pdf
 | 
 
 
	
		| 5106 | 6-(4-dimethylamino-3-hydroxy-6-methyl-oxan-2-yl)oxy-14-ethyl-7,12,13-trihydroxy-4-(5-hydroxy-4-methoxy-4 ,6-dimethyl-oxan-2-yl)oxy-10-(2-methoxyethoxymethoxyimino)-3,5,7,9,11,13-hexamethyl-1-oxacyclotetradecan
 -2-one
 |  
		| 54548 | (3R,4S,5S,6R,7R,9R,11S,12R,13R,14R)-6-(4-dimethylamino-3-hydroxy-6-methyl-oxan-2-yl)oxy-14-ethyl-7,12,13 -trihydroxy-4-(5-hydroxy-4-methoxy-4,6-dimethyl-oxan-2-yl)oxy-10-(2-methoxyethoxymethoxyimino)-3,5,7,9,1
 1,13-hexamethyl-1-oxacyclotetradecan-2-one
 |  
		| 444037 | (3R,4S,5S,6R,7R,9R,11S,12R,13R,14R)-6-[(2S,3R,4S,6R)-4-dimethylamino-3-hydroxy-6-methyl-oxan-2-yl]oxy-14 -ethyl-7,12,13-trihydroxy-4-[(2S,4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyl-oxan-2-yl]oxy-10-(2-methoxye
 thoxymethoxyimino)-3,5,7,9,11,13-hexamethyl-1-oxacyclotetradecan-2-one
 |  
		| 5362068 | (3R,4S,5S,6R,7R,9R,10E,11S,12R,13R,14R)-6-(4-dimethylamino-3-hydroxy-6-methyl-oxan-2-yl)oxy-14-ethyl-7,1 2,13-trihydroxy-4-(5-hydroxy-4-methoxy-4,6-dimethyl-oxan-2-yl)oxy-10-(2-methoxyethoxymethoxyimino)-3,5,7
 ,9,11,13-hexamethyl-1-oxacyclotetradecan-2-one
 |  
		| 5480431 | (3R,4S,5S,6R,7R,9R,10E,11S,12R,13R,14R)-6-[(2S,3R,4S,6R)-4-dimethylamino-3-hydroxy-6-methyl-oxan-2-yl]ox y-14-ethyl-7,12,13-trihydroxy-4-[(2S,4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyl-oxan-2-yl]oxy-10-(2-meth
 oxyethoxymethoxyimino)-3,5,7,9,11,13-hexamethyl-1-oxacyclotetradecan-2-one
 |  
		| 5480438 | (3R,4S,5S,6R,7R,9R,10E,12R,13R,14R)-6-(4-dimethylamino-3-hydroxy-6-methyl-oxan-2-yl)oxy-14-ethyl-7,12,13 -trihydroxy-4-(5-hydroxy-4-methoxy-4,6-dimethyl-oxan-2-yl)oxy-10-(2-methoxyethoxymethoxyimino)-3,5,7,9,1
 1,13-hexamethyl-1-oxacyclotetradecan-2-one
 |  
 | internal high similarity DBLink  | Rows returned: 0 |  | 
 
 | active | Cluster 14145 | Additional Members: 11 | Rows returned: 1 |  | 
 
 |