| Compound Information | SONAR Target prediction | | Name: | ROXITHROMYCIN | | Unique Identifier: | SPE01503276 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 760.443 g/mol | | X log p: | -1.64 (online calculus) | | Lipinksi Failures | 2 | | TPSA | 115.74 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 15 | | Rotatable Bond Count: | 13 | | Canonical Smiles: | CCC1OC(=O)C(C)C(OC2CC(C)(OC)C(O)C(C)O2)C(C)C(OC2OC(C)CC(C2O)N(C)C)C(C) (O)CC(C)C(=NOCOCCOC)C(C)C(O)C1(C)O | | Source: | semisynthetic; RU-28965, RU-965 | | Therapeutics: | antibacterial |
| Species: |
4932 |
| Condition: |
HOG1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6890±0.0311127 |
| Normalized OD Score: sc h |
0.9671±0.00193932 |
| Z-Score: |
-0.9038±0.0977588 |
| p-Value: |
0.367222 |
| Z-Factor: |
-4.85103 |
| Fitness Defect: |
1.0018 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum_ED | | Plate Number and Position: | 8|A2 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 595 nm | | Robot Temperature: | 30.00 Celcius | | Date: | 2010-08-10 YYYY-MM-DD | | Plate CH Control (+): | 0.09425±0.01133 | | Plate DMSO Control (-): | 0.867±0.03628 | | Plate Z-Factor: | 0.8398 |
| png ps pdf |
| 5837004 |
(10Z)-6-(4-dimethylamino-3-hydroxy-6-methyl-oxan-2-yl)oxy-14-ethyl-7,12,13-trihydroxy-4-(5-hydroxy-4-met hoxy-4,6-dimethyl-oxan-2-yl)oxy-10-(2-methoxyethoxymethoxyimino)-3,5,7,9,11,13-hexamethyl-1-oxacyclotetr adecan-2-one |
| 6426702 |
(3R,4S,5S,6R,7R,9R,10E,11S,12R,13R,14R)-6-[(2S,4R)-4-dimethylamino-3-hydroxy-6-methyl-oxan-2-yl]oxy-14-e thyl-7,12,13-trihydroxy-4-(5-hydroxy-4-methoxy-4,6-dimethyl-oxan-2-yl)oxy-10-(2-methoxyethoxymethoxyimin o)-3,5,7,9,11,13-hexamethyl-1-oxacyclotetradecan-2-one |
| 6604440 |
(3R,4R,5S,6S,7R,9S,10E,11S,12S,13R,14S)-6-[(2S,3S,4R,6S)-4-dimethylamino-3-hydroxy-6-methyl-oxan-2-yl]ox y-14-ethyl-7,12,13-trihydroxy-4-[(2R,4S,5R,6S)-5-hydroxy-4-methoxy-4,6-dimethyl-oxan-2-yl]oxy-10-(2-meth oxyethoxymethoxyimino)-3,5,7,9,11,13-hexamethyl-1-oxacyclotetradecan-2-one |
| 6915744 |
(3R,4S,5S,6R,7R,9R,10E,11S,12R,13R,14R)-6-[(2S,3R,4S,6R)-4-dimethylamino-3-hydroxy-6-methyl-oxan-2-yl]ox y-14-ethyl-7,12,13-trihydroxy-4-[(2S,4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyl-oxan-2-yl]oxy-10-(2-meth oxyethoxymethoxyimino)-3,5,7,9,11,13-hexamethyl-1-oxacyclotetradecan-2-one |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 14145 | Additional Members: 11 | Rows returned: 1 | |
|