| Compound Information | SONAR Target prediction | | Name: | HYDROCORTISONE BUTYRATE | | Unique Identifier: | SPE01503273 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 397.272 g/mol | | X log p: | -0.605 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 60.44 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 6 | | Rotatable Bond Count: | 6 | | Canonical Smiles: | CCCC(=O)OC1(CCC2C3CCC4=CC(=O)CCC4(C)C3C(O)CC21C)C(=O)CO | | Source: | semisynthetic | | Therapeutics: | glucocorticoid, antiinflammatory |
| Species: |
4932 |
| Condition: |
ABP1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7019±0.00445477 |
| Normalized OD Score: sc h |
1.0083±0.00172973 |
| Z-Score: |
0.4213±0.110762 |
| p-Value: |
0.674468 |
| Z-Factor: |
-4.62856 |
| Fitness Defect: |
0.3938 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 20|C3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 23.30 Celcius | | Date: | 2007-12-20 YYYY-MM-DD | | Plate CH Control (+): | 0.0417±0.00084 | | Plate DMSO Control (-): | 0.67665±0.01508 | | Plate Z-Factor: | 0.9229 |
| png ps pdf |
| DBLink | Rows returned: 6 | |
| 3642 |
[11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a ]phenanthren-17-yl] butanoate |
| 26133 |
[(8S,9S,10R,11S,13S,14S,17R)-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15, 16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] butanoate |
| 42395 |
[(17R)-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclop enta[a]phenanthren-17-yl] pentanoate |
| 5225092 |
[11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a ]phenanthren-17-yl] pentanoate |
| 5282494 |
[(8S,9S,10R,11S,13S,14S,17R)-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15, 16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] pentanoate |
| 5702240 |
[(8S,10R,11S,13S,17R)-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-deca hydro-1H-cyclopenta[a]phenanthren-17-yl] butanoate |
| internal high similarity DBLink | Rows returned: 4 | |
| active | Cluster 10196 | Additional Members: 12 | Rows returned: 0 | |
|