Compound Information | SONAR Target prediction | Name: | 6alpha-METHYLPREDNISOLONE ACETATE | Unique Identifier: | SPE01503254 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 384.253 g/mol | X log p: | 3.941 (online calculus) | Lipinksi Failures | 0 | TPSA | 60.44 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 6 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC1CC2C3CCC(O)(C(=O)COC(C)=O)C3(C)CC(O)C2C2(C)C=CC(=O)C=C12 | Source: | semisynthetic | Therapeutics: | glucocorticoid |
Species: |
4932 |
Condition: |
IDH2 |
Replicates: |
2 |
Raw OD Value: r im |
0.5877±0.00183848 |
Normalized OD Score: sc h |
1.0067±0.00872078 |
Z-Score: |
0.3390±0.445161 |
p-Value: |
0.746974 |
Z-Factor: |
-8.28974 |
Fitness Defect: |
0.2917 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 21|B5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.10 Celcius | Date: | 2007-10-19 YYYY-MM-DD | Plate CH Control (+): | 0.041275000000000006±0.00051 | Plate DMSO Control (-): | 0.572075±0.12138 | Plate Z-Factor: | 0.2407 |
| png ps pdf |
7059634 |
[2-[(6S,8S,9R,10S,11S,13S,14S,17R)-11,17-dihydroxy-6,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydr o-6H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
7061371 |
[2-[(6S,8S,9R,10S,11S,13S,14R,17R)-11,17-dihydroxy-6,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydr o-6H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
7061372 |
[2-[(6S,8S,9R,10S,11R,13S,14S,17R)-11,17-dihydroxy-6,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydr o-6H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
7061373 |
[2-[(6S,8S,9R,10S,11R,13S,14R,17R)-11,17-dihydroxy-6,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydr o-6H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
internal high similarity DBLink | Rows returned: 6 | |
active | Cluster 8234 | Additional Members: 4 | Rows returned: 0 | |
|