Compound Information | SONAR Target prediction | Name: | FIPEXIDE HYDROCHLORIDE | Unique Identifier: | SPE01503222 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C20Cl2H22N2O4 | Molecular Weight: | 403.13 g/mol | X log p: | 16.306 (online calculus) | Lipinksi Failures | 1 | TPSA | 51.24 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 6 | Rotatable Bond Count: | 6 | Canonical Smiles: | Cl.Clc1ccc(OCC(=O)N2CCN(CC2)Cc2ccc3OCOc3c2)cc1 | Therapeutics: | psychostimulant |
Species: |
4932 |
Condition: |
IRE1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6982±0.00558614 |
Normalized OD Score: sc h |
0.9745±0.000850482 |
Z-Score: |
-1.2317±0.0838033 |
p-Value: |
0.21887 |
Z-Factor: |
-2.6104 |
Fitness Defect: |
1.5193 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 13|H4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.50 Celcius | Date: | 2007-11-23 YYYY-MM-DD | Plate CH Control (+): | 0.040124999999999994±0.00155 | Plate DMSO Control (-): | 0.703675±0.01716 | Plate Z-Factor: | 0.9133 |
| png ps pdf |
DBLink | Rows returned: 3 | |
3351 |
1-[4-(benzo[1,3]dioxol-5-ylmethyl)piperazin-1-yl]-2-(4-chlorophenoxy)ethanone |
161803 |
1-[4-(benzo[1,3]dioxol-5-ylmethyl)piperazin-1-yl]-2-(4-chlorophenoxy)ethanone hydrochloride |
6957679 |
1-[4-(benzo[1,3]dioxol-5-ylmethyl)-2,3,5,6-tetrahydropyrazin-1-yl]-2-(4-chlorophenoxy)ethanone |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 5376 | Additional Members: 64 | Rows returned: 1 | |
|