| 
 | Compound Information | SONAR Target prediction |  | Name: | BETAMETHASONE 17,21-DIPROPIONATE |  | Unique Identifier: | SPE01503210 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 467.294 g/mol |  | X log p: | 4.522  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 86.74 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 7 |  | Rotatable Bond Count: | 8 |  | Canonical Smiles: | CCC(=O)OCC(=O)C1(OC(=O)CC)C(C)CC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC21C |  | Source: | semisynthetic |  | Therapeutics: | glucocorticoid, antiinflammatory | 
 
 
	
		| Species: | 4932 |  
		| Condition: | FKS1 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.4199±0.00572756 |  
		| Normalized OD Score: sc h | 0.7407±0.00480018 |  
		| Z-Score: | -4.9740±0.486578 |  
		| p-Value: | 0.0000018816 |  
		| Z-Factor: | 0.453466 |  
		| Fitness Defect: | 13.1834 |  
		| Bioactivity Statement: | Active |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 10|A7 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 23.10 Celcius |  | Date: | 2006-04-11 YYYY-MM-DD |  | Plate CH Control (+): | 0.040249999999999994±0.00160 |  | Plate DMSO Control (-): | 0.5497±0.02449 |  | Plate Z-Factor: | 0.8558 | 
 |  png ps
 pdf
 | 
 
 
	
		| 21800 | [2-[(8S,9R,10S,11S,13S,14S,16S,17R)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-17-propanoyloxy-6,7,8,1 1,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] propanoate
 |  
		| 63049 | [2-[(8S,9R,10S,11S,13S,14S,16R,17R)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-17-propanoyloxy-6,7,8,1 1,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] propanoate
 |  
		| 71470 | [(8S,9R,10S,11S,13S,14S,16S,17R)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-17-(2-propanoyloxyacetyl)- 6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] butanoate
 |  
		| 111080 | [(8S,9R,10S,11S,13S,14S,16S,17R)-17-(2-acetyloxyacetyl)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7 ,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] 2-methylpropanoate
 |  
		| 111111 | [(8S,9R,10S,11S,13S,14S,16S,17R)-17-(2-acetyloxyacetyl)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7 ,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate
 |  
		| 135410 | [(8S,10S,11S,13S,14S,16S,17R)-9-fluoro-11-hydroxy-17-(2-methoxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8,11 ,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] propanoate
 |  
 | internal high similarity DBLink  | Rows returned: 3 |  | 
 
 | active | Cluster 1865 | Additional Members: 13 | Rows returned: 2 |  | 
 
 |