Compound Information | SONAR Target prediction | Name: | BETAMETHASONE 17,21-DIPROPIONATE | Unique Identifier: | SPE01503210 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 467.294 g/mol | X log p: | 4.522 (online calculus) | Lipinksi Failures | 0 | TPSA | 86.74 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 7 | Rotatable Bond Count: | 8 | Canonical Smiles: | CCC(=O)OCC(=O)C1(OC(=O)CC)C(C)CC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC21C | Source: | semisynthetic | Therapeutics: | glucocorticoid, antiinflammatory |
Species: |
4932 |
Condition: |
FKS1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6508±0.00572756 |
Normalized OD Score: sc h |
0.7407±0.00480018 |
Z-Score: |
-4.9740±0.486578 |
p-Value: |
0.0000018816 |
Z-Factor: |
0.453466 |
Fitness Defect: |
13.1834 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 20|A8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.60 Celcius | Date: | 2008-06-04 YYYY-MM-DD | Plate CH Control (+): | 0.04055±0.00119 | Plate DMSO Control (-): | 0.63235±0.01361 | Plate Z-Factor: | 0.9040 |
| png ps pdf |
4630258 |
[9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-17-(2-propanoyloxyacetyl)-6,7,8,11,12,14,15,16-octahydrocy clopenta[a]phenanthren-17-yl] butanoate |
6553933 |
[2-[(8S,9S,10S,11R,13R,14S,16S,17S)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-17-propanoyloxy-6,7,8,1 1,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] propanoate |
6576662 |
[2-[(8R,9R,10R,11S,13R,14R,16R,17R)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-17-pentanoyloxy-6,7,8,1 1,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] pentanoate |
6708733 |
[2-[(10S,11S,13S,16S,17R)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-17-propanoyloxy-6,7,8,11,12,14,15 ,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] propanoate |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 1865 | Additional Members: 13 | Rows returned: 2 | |
|