| Compound Information | SONAR Target prediction |  | Name: | THIAMPHENICOL |  | Unique Identifier: | SPE01503136  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 341.104 g/mol |  | X log p: | 7.295  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 59.59 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 6 |  | Rotatable Bond Count: | 7 |  | Canonical Smiles: | CS(=O)(=O)c1ccc(cc1)C(O)C(CO)NC(=O)C(Cl)Cl |  | Source: | synthetic |  | Therapeutics: | antibacterial |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		TOP1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.6649±0.00975807 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9848±0.00322386 | 
	 
	
		| Z-Score: | 
		-0.2462±0.0641188 | 
	 
	
		| p-Value: | 
		0.80571 | 
	 
	
		| Z-Factor: | 
		-4.83965 | 
	 
	
		| Fitness Defect: | 
		0.216 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 21|A10 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.80 Celcius |  | Date: | 2006-04-26 YYYY-MM-DD |  | Plate CH Control (+): | 0.0395±0.00122 |  | Plate DMSO Control (-): | 0.623±0.02060 |  | Plate Z-Factor: | 0.9000 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 3 |  |  
 
	
		| 5433 | 
		2,2-dichloro-N-[1,3-dihydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide | 
	 
	
		| 27200 | 
		2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide | 
	 
	
		| 146678 | 
		2,2-dichloro-N-[(1S,2S)-1,3-dihydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide | 
	 
 
 | internal high similarity DBLink  | Rows returned: 0 |  |  
 
 |  nonactive | Cluster 681 | Additional Members: 8 | Rows returned: 6 |  |   
 
 |