| Compound Information | SONAR Target prediction |  | Name: | THIAMPHENICOL |  | Unique Identifier: | SPE01503136  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 341.104 g/mol |  | X log p: | 7.295  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 59.59 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 6 |  | Rotatable Bond Count: | 7 |  | Canonical Smiles: | CS(=O)(=O)c1ccc(cc1)C(O)C(CO)NC(=O)C(Cl)Cl |  | Source: | synthetic |  | Therapeutics: | antibacterial |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		pdr_yCG196 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.7875±0.0148492 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0251±0.0141142 | 
	 
	
		| Z-Score: | 
		0.8429±0.478436 | 
	 
	
		| p-Value: | 
		0.42569 | 
	 
	
		| Z-Factor: | 
		-2.20828 | 
	 
	
		| Fitness Defect: | 
		0.854 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum_ED |  | Plate Number and Position: | 7|E7 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 595 nm |  | Robot Temperature: | 30.00 Celcius |  | Date: | 2010-08-10 YYYY-MM-DD |  | Plate CH Control (+): | 0.08925±0.00980 |  | Plate DMSO Control (-): | 0.95325±0.01358 |  | Plate Z-Factor: | 0.9465 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 3 |  |  
 
	
		| 5433 | 
		2,2-dichloro-N-[1,3-dihydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide | 
	 
	
		| 27200 | 
		2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide | 
	 
	
		| 146678 | 
		2,2-dichloro-N-[(1S,2S)-1,3-dihydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide | 
	 
 
 | internal high similarity DBLink  | Rows returned: 0 |  |  
 
 |  nonactive | Cluster 681 | Additional Members: 8 | Rows returned: 6 |  |   
 
 |