| Compound Information | SONAR Target prediction | | Name: | BENDROFLUMETHIAZIDE | | Unique Identifier: | SPE01503104 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 407.306 g/mol | | X log p: | 13.723 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 85.04 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 7 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | NS(=O)(=O)c1cc2c(NC(Cc3ccccc3)NS2(=O)=O)cc1C(F)(F)F | | Source: | synthetic | | Therapeutics: | diuretic, antihypertensive | | Generic_name: | Bendroflumethiazide | | Chemical_iupac_name: | 3-benzyl-5,5-dioxo-9-(trifluoromethyl)-5$l^{6}-thia-2,4-diazabicyclo[4.4.0]deca-7,9, 11-triene-8-sulfonamide | | Drug_type: | Approved Drug | | Pharmgkb_id: | PA448563 | | Kegg_compound_id: | C07758 | | Drugbank_id: | APRD00666 | | Melting_point: | 221-223 oC | | H2o_solubility: | 108 mg/L | | Logp: | 2.085 | | Isoelectric_point: | 8.5 | | Cas_registry_number: | 73-48-3 | | Drug_category: | Diuretics, Thiazide; Antihypertensive Agents; ATC:C03AA01 | | Indication: | For the treatment of high blood pressure and management of edema | | Pharmacology: | Bendroflumethiazide, a thiazide diuretic, removes excess water from the body by increasing how often you urinate (pass water) and also widens the blood vessels which helps to reduce blood pressure. It inhibits Na+/Cl- reabsorption from the distal convoluted tubules in the kidneys. Thiazides also cause loss of potassium and an increase in serum uric acid. Thiazides are often used to treat hypertension, but their hypotensive effects are not necessarily due to their diuretic activity. Thiazides have been shown to prevent hypertension-related morbidity and mortality although the mechanism is not fully understood. Thiazides cause vasodilation by activating calcium-activated potassium channels (large conductance) in vascular smooth muscles and inhibiting various carbonic anhydrases in vascular tissue. | | Mechanism_of_action: | As a diuretic, bendroflumethiazide inhibits active chloride reabsorption at the early distal tubule via the Na-Cl cotransporter, resulting in an increase in the excretion of sodium, chloride, and water. Thiazides like bendroflumethiazide also inhibit sodium ion transport across the renal tubular epithelium through binding to the thiazide sensitive sodium-chloride transporter. This results in an increase in potassium excretion via the sodium-potassium exchange mechanism. The antihypertensive mechanism of bendroflumethiazide is less well understood although it may be mediated through its action on carbonic anhydrases in the smooth muscle or through its action on the large-conductance calcium-activated potassium (KCa) channel, also found in the smooth muscle. | | Organisms_affected: | Humans and other mammals |
| Species: |
4932 |
| Condition: |
BY4741-2nd |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6898±0.000494975 |
| Normalized OD Score: sc h |
0.9858±0.000973325 |
| Z-Score: |
0.1984±0.0455637 |
| p-Value: |
0.84278 |
| Z-Factor: |
-6.1068 |
| Fitness Defect: |
0.171 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 19|H11 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 22.60 Celcius | | Date: | 2008-02-08 YYYY-MM-DD | | Plate CH Control (+): | 0.04020000000000001±0.00067 | | Plate DMSO Control (-): | 0.6820250000000002±0.01662 | | Plate Z-Factor: | 0.9145 |
| png ps pdf |
| DBLink | Rows returned: 2 | |
| 2315 |
8-benzyl-10,10-dioxo-4-(trifluoromethyl)-10$l^{6}-thia-7,9-diazabicyclo[4.4.0]deca-2,4,11-triene-3-sulfo namide |
| 6604206 |
(8S)-8-benzyl-10,10-dioxo-4-(trifluoromethyl)-10$l^{6}-thia-7,9-diazabicyclo[4.4.0]deca-2,4,11-triene-3- sulfonamide |
| internal high similarity DBLink | Rows returned: 0 | |
|