| Compound Information | SONAR Target prediction | | Name: | BACAMPICILLIN HYDROCHLORIDE | | Unique Identifier: | SPE01503102 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 473.759 g/mol | | X log p: | 9.772 (online calculus) | | Lipinksi Failures | 2 | | TPSA | 124.51 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 10 | | Rotatable Bond Count: | 11 | | Canonical Smiles: | Cl.CCOC(=O)OC(C)OC(=O)C1N2C(SC1(C)C)C(NC(=O)C(N)c1ccccc1)C2=O | | Source: | semisynthetic | | Therapeutics: | antibacterial |
| Species: |
4932 |
| Condition: |
MED2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5588±0.00296985 |
| Normalized OD Score: sc h |
0.9829±0.00578887 |
| Z-Score: |
-0.7621±0.265391 |
| p-Value: |
0.453946 |
| Z-Factor: |
-5.92333 |
| Fitness Defect: |
0.7898 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 19|H10 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.20 Celcius | | Date: | 2008-04-29 YYYY-MM-DD | | Plate CH Control (+): | 0.041175±0.00032 | | Plate DMSO Control (-): | 0.54335±0.01709 | | Plate Z-Factor: | 0.9074 |
| png ps pdf |
| 2282 |
1-ethoxycarbonyloxyethyl 6-[(2-amino-2-phenyl-acetyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| 39849 |
1-ethoxycarbonyloxyethyl (2S,5R)-6-[[(2R)-2-amino-2-phenyl-acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-c arboxylate |
| 71429 |
1-ethoxycarbonyloxyethyl (2S,5R)-6-[[(2R)-2-amino-2-phenyl-acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-c arboxylate hydrochloride |
| 441397 |
1-ethoxycarbonyloxyethyl (2S,5R,6R)-6-[[(2R)-2-amino-2-phenyl-acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane- 2-carboxylate |
| 441398 |
1-ethoxycarbonyloxyethyl (2S,5R,6R)-6-[[(2R)-2-amino-2-phenyl-acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane- 2-carboxylate hydrochloride |
| 5311013 |
1-ethoxycarbonyloxyethyl (2S,5R,6R)-6-[[(2S)-2-amino-2-phenyl-acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane- 2-carboxylate |
| internal high similarity DBLink | Rows returned: 0 | |
|