| Compound Information | SONAR Target prediction | | Name: | BACAMPICILLIN HYDROCHLORIDE | | Unique Identifier: | SPE01503102 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 473.759 g/mol | | X log p: | 9.772 (online calculus) | | Lipinksi Failures | 2 | | TPSA | 124.51 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 10 | | Rotatable Bond Count: | 11 | | Canonical Smiles: | Cl.CCOC(=O)OC(C)OC(=O)C1N2C(SC1(C)C)C(NC(=O)C(N)c1ccccc1)C2=O | | Source: | semisynthetic | | Therapeutics: | antibacterial |
| Species: |
4932 |
| Condition: |
BCK1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.8595±0.000919239 |
| Normalized OD Score: sc h |
0.9772±0.0058498 |
| Z-Score: |
-0.9966±0.131939 |
| p-Value: |
0.321072 |
| Z-Factor: |
-1.44022 |
| Fitness Defect: |
1.1361 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum_ED | | Plate Number and Position: | 7|D8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 595 nm | | Robot Temperature: | 30.00 Celcius | | Date: | 2010-08-10 YYYY-MM-DD | | Plate CH Control (+): | 0.09475±0.00655 | | Plate DMSO Control (-): | 0.9557500000000001±0.02304 | | Plate Z-Factor: | 0.8724 |
|  png
ps
pdf |
| 5702218 |
1-ethoxycarbonyloxyethyl
6-[[(2R)-2-amino-2-phenyl-acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxyla
te hydrochloride |
| 5702219 |
1-ethoxycarbonyloxyethyl
6-[[(2R)-2-amino-2-phenyl-acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxyla
te |
| 6604397 |
[(1S)-1-ethoxycarbonyloxyethyl]
(2S,5R,6R)-6-[[(2S)-2-amino-2-phenyl-acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-
2-carboxylate |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 15024 | Additional Members: 10 | Rows returned: 3 | |
|
