Compound Information | SONAR Target prediction | Name: | AMIPRILOSE | Unique Identifier: | SPE01503083 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 313.606 g/mol | X log p: | -0.87 (online calculus) | Lipinksi Failures | 0 | TPSA | 40.16 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 7 | Rotatable Bond Count: | 7 | Canonical Smiles: | Cl.CN(C)CCCOC1C(OC2OC(C)(C)OC21)C(O)CO | Source: | semisynthetic | Therapeutics: | immunomodulator, antiinflammatory |
Species: |
4932 |
Condition: |
SHM2 |
Replicates: |
2 |
Raw OD Value: r im |
0.7521±0.00289914 |
Normalized OD Score: sc h |
0.9854±0.000637967 |
Z-Score: |
-0.5403±0.00391651 |
p-Value: |
0.58899 |
Z-Factor: |
-4.93168 |
Fitness Defect: |
0.5293 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 23|G10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.80 Celcius | Date: | 2006-04-08 YYYY-MM-DD | Plate CH Control (+): | 0.038125±0.00199 | Plate DMSO Control (-): | 0.751875±0.01361 | Plate Z-Factor: | 0.9322 |
| png ps pdf |
2158 |
1-[4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane-1,2-diol |
43261 |
1-[(1R,3R,4S,5R)-4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane-1,2-d iol hydrochloride |
43262 |
1-[(1R,3R,4S,5R)-4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane-1,2-d iol |
121928 |
(1R)-1-[(1R,3R,4S,5R)-4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane- 1,2-diol |
124163 |
3-[[(1R,3R,4S,5R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-4-y l]oxy]-N,N-dimethyl-propan-1-amine |
5702212 |
1-[(3R,4S,5R)-4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane-1,2-diol hydrochloride |
internal high similarity DBLink | Rows returned: 1 | |
active | Cluster 11451 | Additional Members: 4 | Rows returned: 0 | |
|