| 
 | Compound Information | SONAR Target prediction |  | Name: | AMIPRILOSE |  | Unique Identifier: | SPE01503083 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 313.606 g/mol |  | X log p: | -0.87  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 40.16 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 7 |  | Rotatable Bond Count: | 7 |  | Canonical Smiles: | Cl.CN(C)CCCOC1C(OC2OC(C)(C)OC21)C(O)CO |  | Source: | semisynthetic |  | Therapeutics: | immunomodulator, antiinflammatory | 
 
 
	
		| Species: | 4932 |  
		| Condition: | BY4741 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.7108±0.024678 |  
		| Normalized OD Score: sc h | 0.9437±0.0255582 |  
		| Z-Score: | -3.6793±0.807363 |  
		| p-Value: | 0.000951304 |  
		| Z-Factor: | -0.31867 |  
		| Fitness Defect: | 6.9577 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 23|G10 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 28.20 Celcius |  | Date: | 2005-12-15 YYYY-MM-DD |  | Plate CH Control (+): | 0.038450000000000005±0.00115 |  | Plate DMSO Control (-): | 0.7723249999999999±0.01099 |  | Plate Z-Factor: | 0.9489 | 
 |  png ps
 pdf
 | 
 
 
	
		| 2158 | 1-[4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane-1,2-diol |  
		| 43261 | 1-[(1R,3R,4S,5R)-4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane-1,2-d iol hydrochloride
 |  
		| 43262 | 1-[(1R,3R,4S,5R)-4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane-1,2-d iol
 |  
		| 121928 | (1R)-1-[(1R,3R,4S,5R)-4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane- 1,2-diol
 |  
		| 124163 | 3-[[(1R,3R,4S,5R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-4-y l]oxy]-N,N-dimethyl-propan-1-amine
 |  
		| 5702212 | 1-[(3R,4S,5R)-4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane-1,2-diol hydrochloride
 |  
 | internal high similarity DBLink  | Rows returned: 1 |  | 
 
 | active | Cluster 11451 | Additional Members: 4 | Rows returned: 0 |  | 
 
 |