| Compound Information | SONAR Target prediction | | Name: | AMIPRILOSE | | Unique Identifier: | SPE01503083 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 313.606 g/mol | | X log p: | -0.87 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 40.16 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 7 | | Rotatable Bond Count: | 7 | | Canonical Smiles: | Cl.CN(C)CCCOC1C(OC2OC(C)(C)OC21)C(O)CO | | Source: | semisynthetic | | Therapeutics: | immunomodulator, antiinflammatory |
| Species: |
4932 |
| Condition: |
DOA4 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6294±0.00982878 |
| Normalized OD Score: sc h |
0.9892±0.00768147 |
| Z-Score: |
-0.4222±0.300866 |
| p-Value: |
0.679746 |
| Z-Factor: |
-8.43534 |
| Fitness Defect: |
0.386 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 19|H7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.10 Celcius | | Date: | 2008-05-02 YYYY-MM-DD | | Plate CH Control (+): | 0.040975±0.00208 | | Plate DMSO Control (-): | 0.617175±0.01739 | | Plate Z-Factor: | 0.8932 |
| png ps pdf |
| 2158 |
1-[4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane-1,2-diol |
| 43261 |
1-[(1R,3R,4S,5R)-4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane-1,2-d iol hydrochloride |
| 43262 |
1-[(1R,3R,4S,5R)-4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane-1,2-d iol |
| 121928 |
(1R)-1-[(1R,3R,4S,5R)-4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane- 1,2-diol |
| 124163 |
3-[[(1R,3R,4S,5R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-4-y l]oxy]-N,N-dimethyl-propan-1-amine |
| 5702212 |
1-[(3R,4S,5R)-4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane-1,2-diol hydrochloride |
| internal high similarity DBLink | Rows returned: 1 | |
| active | Cluster 11451 | Additional Members: 4 | Rows returned: 0 | |
|