| Compound Information | SONAR Target prediction |  | Name: | AMIPRILOSE |  | Unique Identifier: | SPE01503083  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 313.606 g/mol |  | X log p: | -0.87  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 40.16 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 7 |  | Rotatable Bond Count: | 7 |  | Canonical Smiles: | Cl.CN(C)CCCOC1C(OC2OC(C)(C)OC21)C(O)CO |  | Source: | semisynthetic |  | Therapeutics: | immunomodulator, antiinflammatory |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		SPE00330001 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.5146±0.0499217 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0149±0.00796546 | 
	 
	
		| Z-Score: | 
		0.3575±0.222861 | 
	 
	
		| p-Value: | 
		0.724022 | 
	 
	
		| Z-Factor: | 
		-5.64537 | 
	 
	
		| Fitness Defect: | 
		0.3229 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | SpectrumTMP |  | Plate Number and Position: | 2|E9 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 22.40 Celcius |  | Date: | 2006-12-21 YYYY-MM-DD |  | Plate CH Control (+): | 0.040749999999999995±0.00244 |  | Plate DMSO Control (-): | 0.519725±0.05098 |  | Plate Z-Factor: | 0.6296 |  
  |  png ps pdf |  
 
 
	
		| 2158 | 
		1-[4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane-1,2-diol | 
	 
	
		| 43261 | 
		1-[(1R,3R,4S,5R)-4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane-1,2-d iol hydrochloride | 
	 
	
		| 43262 | 
		1-[(1R,3R,4S,5R)-4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane-1,2-d iol | 
	 
	
		| 121928 | 
		(1R)-1-[(1R,3R,4S,5R)-4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane- 1,2-diol | 
	 
	
		| 124163 | 
		3-[[(1R,3R,4S,5R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-4-y l]oxy]-N,N-dimethyl-propan-1-amine | 
	 
	
		| 5702212 | 
		1-[(3R,4S,5R)-4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane-1,2-diol hydrochloride | 
	 
 
 | internal high similarity DBLink  | Rows returned: 1 |  |   
 |  active | Cluster 11451 | Additional Members: 4 | Rows returned: 0 |  |  
  
 |