| Compound Information | SONAR Target prediction | | Name: | AMIPRILOSE | | Unique Identifier: | SPE01503083 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 313.606 g/mol | | X log p: | -0.87 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 40.16 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 7 | | Rotatable Bond Count: | 7 | | Canonical Smiles: | Cl.CN(C)CCCOC1C(OC2OC(C)(C)OC21)C(O)CO | | Source: | semisynthetic | | Therapeutics: | immunomodulator, antiinflammatory |
| Species: |
4932 |
| Condition: |
MCK1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5001±0.0103945 |
| Normalized OD Score: sc h |
0.8714±0.0184272 |
| Z-Score: |
-5.5053±1.21299 |
| p-Value: |
0.00000167963 |
| Z-Factor: |
-1.16249 |
| Fitness Defect: |
13.2969 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 23|G10 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.80 Celcius | | Date: | 2007-11-13 YYYY-MM-DD | | Plate CH Control (+): | 0.039749999999999994±0.00178 | | Plate DMSO Control (-): | 0.57205±0.03761 | | Plate Z-Factor: | 0.7665 |
|  png
ps
pdf |
| 5702213 |
1-[(3R,4S,5R)-4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane-1,2-diol |
| 6420050 |
1-[(3R,4S,5S)-4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane-1,2-diol
hydrochloride |
| 6602490 |
(1S)-1-[(4S,5S)-4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane-1,2-di
ol |
| 6603708 |
(1R)-1-[(1S,3S,4S,5R)-4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane-
1,2-diol |
| 6604419 |
(1R)-1-[(1S,3R,4R,5S)-4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane-
1,2-diol |
| 6713980 |
1-[(3R,4S,5S)-4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane-1,2-diol |
| internal high similarity DBLink | Rows returned: 1 | |
| active | Cluster 11451 | Additional Members: 4 | Rows returned: 0 | |
|
