Compound Information | SONAR Target prediction | Name: | RETINYL ACETATE | Unique Identifier: | SPE01503051 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C22H32O2 | Molecular Weight: | 296.234 g/mol | X log p: | 12.918 (online calculus) | Lipinksi Failures | 1 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 7 | Canonical Smiles: | CC(=O)OCC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C | Therapeutics: | vitamin precursor |
Species: |
4932 |
Condition: |
NUM1 |
Replicates: |
2 |
Raw OD Value: r im |
0.7184±0.00360624 |
Normalized OD Score: sc h |
1.0128±0.00733055 |
Z-Score: |
0.5698±0.315927 |
p-Value: |
0.57838 |
Z-Factor: |
-3.3336 |
Fitness Defect: |
0.5475 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 15|F9 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.00 Celcius | Date: | 2006-02-10 YYYY-MM-DD | Plate CH Control (+): | 0.04035±0.00053 | Plate DMSO Control (-): | 0.6824749999999999±0.00762 | Plate Z-Factor: | 0.9600 |
| png ps pdf |
DBLink | Rows returned: 5 | |
5057 |
[3,7-dimethyl-9-(2,6,6-trimethyl-1-cyclohexenyl)nona-2,4,6,8-tetraenyl] acetate |
638034 |
[(2Z,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-1-cyclohexenyl)nona-2,4,6,8-tetraenyl] acetate |
5353925 |
[(2Z,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-1-cyclohexenyl)nona-2,4,6,8-tetraenyl] acetate |
5381733 |
[(2Z,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-1-cyclohexenyl)nona-2,4,6,8-tetraenyl] acetate |
16036981 |
[(2E,4E,6E)-3,5-dimethyl-7-(2,6,6-trimethyl-1-cyclohexenyl)hepta-2,4,6-trienyl] acetate |
internal high similarity DBLink | Rows returned: 0 | |
|