| Compound Information | SONAR Target prediction |
| Name: | ARTEMISININ |
| Unique Identifier: | SPE01503042 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 260.158 g/mol |
| X log p: | -0.127 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 53.99 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 5 |
| Rotatable Bond Count: | 0 |
| Canonical Smiles: | CC1CCC2C(C)C(=O)OC3OC4(C)CCC1C32OO4 |
| Class: | sesquiterpene |
| Source: | Artemisia annua |
| Reference: | Science 228:1049 (1985); Drugs 52:818 (1996); Trends Pharmacol Sci 20:199 (1999) |
| Therapeutics: | antimalarial |
| Found: 157 active | as graph: single | with analogs | [1] << Back 81 82 83 84 85 86 87 88 89 90 Next >> [157] |
| Species: | 4932 |
| Condition: | CLB2 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6292±0.00650538 |
| Normalized OD Score: sc h | 0.9270±0.00125579 |
| Z-Score: | -4.2069±0.0221003 |
| p-Value: | 0.0000259456 |
| Z-Factor: | 0.270564 |
| Fitness Defect: | 10.5595 |
| Bioactivity Statement: | Active |
| ps |
| DBLink | Rows returned: 15 | << Back 1 2 3 |
| 6540821 |
| 6604424 |
| 6604614 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 4356 | Additional Members: 5 | Rows returned: 1 |
| LAT001H11 | 0 |
Service provided by the
Mike Tyers Laboratory