| Compound Information | SONAR Target prediction |
| Name: | ARTEMISININ |
| Unique Identifier: | SPE01503042 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 260.158 g/mol |
| X log p: | -0.127 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 53.99 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 5 |
| Rotatable Bond Count: | 0 |
| Canonical Smiles: | CC1CCC2C(C)C(=O)OC3OC4(C)CCC1C32OO4 |
| Class: | sesquiterpene |
| Source: | Artemisia annua |
| Reference: | Science 228:1049 (1985); Drugs 52:818 (1996); Trends Pharmacol Sci 20:199 (1999) |
| Therapeutics: | antimalarial |
| Found: 157 active | as graph: single | with analogs | 1 2 3 4 5 6 7 8 9 10 Next >> [157] |
| Species: | 4932 |
| Condition: | AAT2 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6210±0.000353553 |
| Normalized OD Score: sc h | 0.8648±0.000109601 |
| Z-Score: | -7.1812±0.152352 |
| p-Value: | 0.000000000000912022 |
| Z-Factor: | 0.641853 |
| Fitness Defect: | 27.7231 |
| Bioactivity Statement: | Active |
| ps |
| DBLink | Rows returned: 15 | 1 2 3 Next >> |
| 2240 |
| 68827 |
| 452191 |
| 536982 |
| 537065 |
| 537182 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 4356 | Additional Members: 5 | Rows returned: 1 |
| LAT001H11 | 0 |
Service provided by the
Mike Tyers Laboratory