| Compound Information | SONAR Target prediction |  | Name: | MORIN |  | Unique Identifier: | SPE01502259  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 292.156 g/mol |  | X log p: | 11.09  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 7 |  | Rotatable Bond Count: | 1 |  | Canonical Smiles: | Oc1ccc(c(O)c1)C1Oc2cc(O)cc(O)c2C(=O)C=1O |  | Class: | flavone |  | Source: | Chlorophora tinctoria |  | Reference: | J Chem Soc 67: 649 (1895) |  | Therapeutics: | P450 and ATPase inhibitor |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		BY4741-3rd | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.6988±0.00721249 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9896±0.0137912 | 
	 
	
		| Z-Score: | 
		0.6339±0.521238 | 
	 
	
		| p-Value: | 
		0.553454 | 
	 
	
		| Z-Factor: | 
		-7.06105 | 
	 
	
		| Fitness Defect: | 
		0.5916 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 9|C10 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.90 Celcius |  | Date: | 2007-09-25 YYYY-MM-DD |  | Plate CH Control (+): | 0.039650000000000005±0.00069 |  | Plate DMSO Control (-): | 0.666125±0.05067 |  | Plate Z-Factor: | 0.7469 |  
  |  png ps pdf |  
 
 
	
		| 3365422 | 
		calcium [2-(2,4-dihydroxyphenyl)-3,7-dihydroxy-4-oxoniumylidene-chromen-5-yl]oxidanium | 
	 
	
		| 5281670 | 
		2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxy-chromen-4-one | 
	 
	
		| 5478571 | 
		3,7-dihydroxy-2-(4-hydroxy-2-oxido-phenyl)-4-oxo-chromen-5-olate; titanium(+4) cation | 
	 
	
		| 5841189 | 
		[5-oxonio-2-(3,5,7-trihydroxy-4-oxo-chromen-2-yl)phenyl]oxidanium; titanium | 
	 
	
		| 6711742 | 
		2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxy-chromen-4-one; titanium | 
	 
	
		| 11980426 | 
		3,7-dihydroxy-2-(4-hydroxy-2-oxido-phenyl)-4-oxoniumylidene-chromen-5-olate; titanium | 
	 
 
 | internal high similarity DBLink  | Rows returned: 8 | 1 2 Next >>  |   
 |  active | Cluster 10732 | Additional Members: 22 | Rows returned: 7 | 1 2 Next >>  |   
 
 |