| Compound Information | SONAR Target prediction | 
| Name: | GLUTATHIONE | 
| Unique Identifier: | SPE01502248  | 
| MolClass: |  Checkout models in ver1.5 and ver1.0 | 
| Molecular Formula: |  | 
| Molecular Weight: | 290.19 g/mol | 
| X log p: | -2.978  (online calculus) | 
| Lipinksi Failures | 1 | 
| TPSA | 68.28 | 
| Hydrogen Bond Donor Count: | 0 | 
| Hydrogen Bond Acceptors Count: | 9 | 
| Rotatable Bond Count: | 11 | 
| Canonical Smiles: | NC(CCC(=O)NC(CS)C(=O)NCC(O)=O)C(O)=O | 
| Class: | amino acid | 
| Source: | plant and animal tissue | 
| Reference: | Pharm Biol 11: 539 (1968) | 
| Therapeutics: | antioxidant | 
| Generic_name: | GLUTHATHIONE | 
| Chemical_iupac_name: | GLUTHATHIONE | 
| Drug_type: | Experimental | 
| Drugbank_id: | EXPT01650 | 
| Logp: | -0.87 +/- 0.74 | 
| Drug_category: | Hematopoietic Prostagladin D Synthase inhibitor | 
| Organisms_affected: | -1 |